C22H24N4S — CID 151072490
6-(7-ethyl-2-methylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole (PubChem CID 151072490) has the molecular formula C22H24N4S and a molecular weight of 376.53 g/mol. Its IUPAC name is 6-(7-ethyl-2-methylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole.
| Compound Name | 6-(7-ethyl-2-methylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 151072490 |
| Molecular Formula | C22H24N4S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 6-(7-ethyl-2-methylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole |
| SMILES | CCc1cc(-c2ccc3nc(C4CCNCC4)sc3c2)cc2cn(C)nc12 |
| InChI | InChI=1S/C22H24N4S/c1-3-14-10-17(11-18-13-26(2)25-21(14)18)16-4-5-19-20(12-16)27-22(24-19)15-6-8-23-9-7-15/h4-5,10-13,15,23H,3,6-9H2,1-2H3 |
| InChIKey | MIKRDMHGZWSGLV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |