C23H23FN4 — CID 174159605
8-(2,7-dimethylindazol-5-yl)-6-fluoro-2-piperidin-4-ylquinoline (PubChem CID 174159605) has the molecular formula C23H23FN4 and a molecular weight of 374.46 g/mol. Its IUPAC name is 8-(2,7-dimethylindazol-5-yl)-6-fluoro-2-piperidin-4-ylquinoline.
| Compound Name | 8-(2,7-dimethylindazol-5-yl)-6-fluoro-2-piperidin-4-ylquinoline |
|---|---|
| PubChem CID | 174159605 |
| Molecular Formula | C23H23FN4 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 8-(2,7-dimethylindazol-5-yl)-6-fluoro-2-piperidin-4-ylquinoline |
| SMILES | Cc1cc(-c2cc(F)cc3ccc(C4CCNCC4)nc23)cc2cn(C)nc12 |
| InChI | InChI=1S/C23H23FN4/c1-14-9-17(10-18-13-28(2)27-22(14)18)20-12-19(24)11-16-3-4-21(26-23(16)20)15-5-7-25-8-6-15/h3-4,9-13,15,25H,5-8H2,1-2H3 |
| InChIKey | FNRQDXMHRLKFBN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |