C12H18N2 — CID 156845071
ethane;2,5,7-trimethylindazole (PubChem CID 156845071) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is ethane;2,5,7-trimethylindazole.
| Compound Name | ethane;2,5,7-trimethylindazole |
|---|---|
| PubChem CID | 156845071 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | ethane;2,5,7-trimethylindazole |
| SMILES | CC.Cc1cc(C)c2nn(C)cc2c1 |
| InChI | InChI=1S/C10H12N2.C2H6/c1-7-4-8(2)10-9(5-7)6-12(3)11-10;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | LDPOAOHELXMSBT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |