C8H8ClN3 — CID 162432890
5-chloro-2,7-dimethylpyrazolo[3,4-c]pyridine (PubChem CID 162432890) has the molecular formula C8H8ClN3 and a molecular weight of 181.63 g/mol. Its IUPAC name is 5-chloro-2,7-dimethylpyrazolo[3,4-c]pyridine.
| Compound Name | 5-chloro-2,7-dimethylpyrazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 162432890 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 5-chloro-2,7-dimethylpyrazolo[3,4-c]pyridine |
| SMILES | Cc1nc(Cl)cc2cn(C)nc12 |
| InChI | InChI=1S/C8H8ClN3/c1-5-8-6(3-7(9)10-5)4-12(2)11-8/h3-4H,1-2H3 |
| InChIKey | AOMZRAICXNFYJE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|