C9H11ClFN3 — CID 168914385
7-fluoro-2,6-dimethylindazol-5-amine;hydrochloride (PubChem CID 168914385) has the molecular formula C9H11ClFN3 and a molecular weight of 215.66 g/mol. Its IUPAC name is 7-fluoro-2,6-dimethylindazol-5-amine;hydrochloride.
| Compound Name | 7-fluoro-2,6-dimethylindazol-5-amine;hydrochloride |
|---|---|
| PubChem CID | 168914385 |
| Molecular Formula | C9H11ClFN3 |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 7-fluoro-2,6-dimethylindazol-5-amine;hydrochloride |
| SMILES | Cc1c(N)cc2cn(C)nc2c1F.Cl |
| InChI | InChI=1S/C9H10FN3.ClH/c1-5-7(11)3-6-4-13(2)12-9(6)8(5)10;/h3-4H,11H2,1-2H3;1H |
| InChIKey | BJOSLMYARSUAFO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|