C10H11FN2O — CID 176566434
(7-fluoro-2,5-dimethylindazol-6-yl)methanol (PubChem CID 176566434) has the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. Its IUPAC name is (7-fluoro-2,5-dimethylindazol-6-yl)methanol.
| Compound Name | (7-fluoro-2,5-dimethylindazol-6-yl)methanol |
|---|---|
| PubChem CID | 176566434 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (7-fluoro-2,5-dimethylindazol-6-yl)methanol |
| SMILES | Cc1cc2cn(C)nc2c(F)c1CO |
| InChI | InChI=1S/C10H11FN2O/c1-6-3-7-4-13(2)12-10(7)9(11)8(6)5-14/h3-4,14H,5H2,1-2H3 |
| InChIKey | POGCJIVZMUPGAE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |