C23H33FN4 — CID 156888629
ethane;7-fluoro-2,5-dimethylindazole;2,5,7-trimethylindazole (PubChem CID 156888629) has the molecular formula C23H33FN4 and a molecular weight of 384.54 g/mol. Its IUPAC name is ethane;7-fluoro-2,5-dimethylindazole;2,5,7-trimethylindazole.
| Compound Name | ethane;7-fluoro-2,5-dimethylindazole;2,5,7-trimethylindazole |
|---|---|
| PubChem CID | 156888629 |
| Molecular Formula | C23H33FN4 |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | ethane;7-fluoro-2,5-dimethylindazole;2,5,7-trimethylindazole |
| SMILES | CC.CC.Cc1cc(C)c2nn(C)cc2c1.Cc1cc(F)c2nn(C)cc2c1 |
| InChI | InChI=1S/C10H12N2.C9H9FN2.2C2H6/c1-7-4-8(2)10-9(5-7)6-12(3)11-10;1-6-3-7-5-12(2)11-9(7)8(10)4-6;2*1-2/h4-6H,1-3H3;3-5H,1-2H3;2*1-2H3 |
| InChIKey | KPJZGQSHLHUITC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |