C12H19N3 — CID 176566989
ethane;N,2,5-trimethylindazol-7-amine (PubChem CID 176566989) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;N,2,5-trimethylindazol-7-amine.
| Compound Name | ethane;N,2,5-trimethylindazol-7-amine |
|---|---|
| PubChem CID | 176566989 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | ethane;N,2,5-trimethylindazol-7-amine |
| SMILES | CC.CNc1cc(C)cc2cn(C)nc12 |
| InChI | InChI=1S/C10H13N3.C2H6/c1-7-4-8-6-13(3)12-10(8)9(5-7)11-2;1-2/h4-6,11H,1-3H3;1-2H3 |
| InChIKey | VOKOPWQBTNNJEX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |