C22H34N6O — CID 176566536
5-amino-2,7-dimethylindazol-6-ol;2,5-dimethylindazol-7-amine;ethane (PubChem CID 176566536) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is 5-amino-2,7-dimethylindazol-6-ol;2,5-dimethylindazol-7-amine;ethane.
| Compound Name | 5-amino-2,7-dimethylindazol-6-ol;2,5-dimethylindazol-7-amine;ethane |
|---|---|
| PubChem CID | 176566536 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 5-amino-2,7-dimethylindazol-6-ol;2,5-dimethylindazol-7-amine;ethane |
| SMILES | CC.CC.Cc1c(O)c(N)cc2cn(C)nc12.Cc1cc(N)c2nn(C)cc2c1 |
| InChI | InChI=1S/C9H11N3O.C9H11N3.2C2H6/c1-5-8-6(4-12(2)11-8)3-7(10)9(5)13;1-6-3-7-5-12(2)11-9(7)8(10)4-6;2*1-2/h3-4,13H,10H2,1-2H3;3-5H,10H2,1-2H3;2*1-2H3 |
| InChIKey | TXEAMRCCGWMLMN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|