C16H16F2N6 — CID 156888280
8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;7-fluoro-2-methylindazol-5-amine (PubChem CID 156888280) has the molecular formula C16H16F2N6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;7-fluoro-2-methylindazol-5-amine.
| Compound Name | 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;7-fluoro-2-methylindazol-5-amine |
|---|---|
| PubChem CID | 156888280 |
| Molecular Formula | C16H16F2N6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;7-fluoro-2-methylindazol-5-amine |
| SMILES | Cc1cn2cc(N)cc(F)c2n1.Cn1cc2cc(N)cc(F)c2n1 |
| InChI | InChI=1S/2C8H8FN3/c1-12-4-5-2-6(10)3-7(9)8(5)11-12;1-5-3-12-4-6(10)2-7(9)8(12)11-5/h2*2-4H,10H2,1H3 |
| InChIKey | ABAGNVQGDQPPFE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|