C12H18N2O — CID 176566676
(2,5-dimethylindazol-6-yl)methanol;ethane (PubChem CID 176566676) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (2,5-dimethylindazol-6-yl)methanol;ethane.
| Compound Name | (2,5-dimethylindazol-6-yl)methanol;ethane |
|---|---|
| PubChem CID | 176566676 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (2,5-dimethylindazol-6-yl)methanol;ethane |
| SMILES | CC.Cc1cc2cn(C)nc2cc1CO |
| InChI | InChI=1S/C10H12N2O.C2H6/c1-7-3-8-5-12(2)11-10(8)4-9(7)6-13;1-2/h3-5,13H,6H2,1-2H3;1-2H3 |
| InChIKey | GGPTVCBSECAUEP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |