C21H27N7S2 — CID 151617655
N-methyl-6-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine (PubChem CID 151617655) has the molecular formula C21H27N7S2 and a molecular weight of 441.63 g/mol. Its IUPAC name is N-methyl-6-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine.
| Compound Name | N-methyl-6-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine |
|---|---|
| PubChem CID | 151617655 |
| Molecular Formula | C21H27N7S2 |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-methyl-6-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine |
| SMILES | Cc1nn2cc(-c3cc4sc(N(C)C5CC(C)(C)NC(C)(C)C5)nc4cn3)nc2s1 |
| InChI | InChI=1S/C21H27N7S2/c1-12-25-28-11-16(24-19(28)29-12)14-7-17-15(10-22-14)23-18(30-17)27(6)13-8-20(2,3)26-21(4,5)9-13/h7,10-11,13,26H,8-9H2,1-6H3 |
| InChIKey | QNVXTHCMTPBMMS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |