C17H22ClN3O2 — CID 166510856
N-[2-chloro-4-[(2-hydroxy-2-methylpropyl)amino]quinolin-3-yl]butanamide (PubChem CID 166510856) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is N-[2-chloro-4-[(2-hydroxy-2-methylpropyl)amino]quinolin-3-yl]butanamide.
| Compound Name | N-[2-chloro-4-[(2-hydroxy-2-methylpropyl)amino]quinolin-3-yl]butanamide |
|---|---|
| PubChem CID | 166510856 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-[2-chloro-4-[(2-hydroxy-2-methylpropyl)amino]quinolin-3-yl]butanamide |
| SMILES | CCCC(=O)Nc1c(Cl)nc2ccccc2c1NCC(C)(C)O |
| InChI | InChI=1S/C17H22ClN3O2/c1-4-7-13(22)21-15-14(19-10-17(2,3)23)11-8-5-6-9-12(11)20-16(15)18/h5-6,8-9,23H,4,7,10H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | KELCHBYIWVVMCX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|