C16H20ClN3O3 — CID 100990683
N-[2-chloro-4-[(2-hydroxy-2-methylpropyl)amino]quinolin-3-yl]-2-methoxyacetamide (PubChem CID 100990683) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is N-[2-chloro-4-[(2-hydroxy-2-methylpropyl)amino]quinolin-3-yl]-2-methoxyacetamide.
| Compound Name | N-[2-chloro-4-[(2-hydroxy-2-methylpropyl)amino]quinolin-3-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 100990683 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[2-chloro-4-[(2-hydroxy-2-methylpropyl)amino]quinolin-3-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1c(Cl)nc2ccccc2c1NCC(C)(C)O |
| InChI | InChI=1S/C16H20ClN3O3/c1-16(2,22)9-18-13-10-6-4-5-7-11(10)19-15(17)14(13)20-12(21)8-23-3/h4-7,22H,8-9H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | XLPFGGRFXSRESB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|