C18H22ClN3O5S — CID 87430646
[2-[[2-chloro-4-[2-(methanesulfonamido)-2-methylpropyl]quinolin-3-yl]amino]-2-oxoethyl] acetate (PubChem CID 87430646) has the molecular formula C18H22ClN3O5S and a molecular weight of 427.91 g/mol. Its IUPAC name is [2-[[2-chloro-4-[2-(methanesulfonamido)-2-methylpropyl]quinolin-3-yl]amino]-2-oxoethyl] acetate.
| Compound Name | [2-[[2-chloro-4-[2-(methanesulfonamido)-2-methylpropyl]quinolin-3-yl]amino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 87430646 |
| Molecular Formula | C18H22ClN3O5S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | [2-[[2-chloro-4-[2-(methanesulfonamido)-2-methylpropyl]quinolin-3-yl]amino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)Nc1c(Cl)nc2ccccc2c1CC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C18H22ClN3O5S/c1-11(23)27-10-15(24)21-16-13(9-18(2,3)22-28(4,25)26)12-7-5-6-8-14(12)20-17(16)19/h5-8,22H,9-10H2,1-4H3,(H,21,24) |
| InChIKey | CPVONFCLAPGHEA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|