C15H18N4O2S — CID 133321544
N-[1-[(2-cyanoquinolin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 133321544) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[1-[(2-cyanoquinolin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide.
| Compound Name | N-[1-[(2-cyanoquinolin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 133321544 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[1-[(2-cyanoquinolin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | CC(C)(CNc1cc(C#N)nc2ccccc12)NS(C)(=O)=O |
| InChI | InChI=1S/C15H18N4O2S/c1-15(2,19-22(3,20)21)10-17-14-8-11(9-16)18-13-7-5-4-6-12(13)14/h4-8,19H,10H2,1-3H3,(H,17,18) |
| InChIKey | MVPORAATJGWMPH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |