C21H19N5 — CID 133346689
4-[3-(1-methylbenzimidazol-2-yl)propylamino]quinoline-2-carbonitrile (PubChem CID 133346689) has the molecular formula C21H19N5 and a molecular weight of 341.42 g/mol. Its IUPAC name is 4-[3-(1-methylbenzimidazol-2-yl)propylamino]quinoline-2-carbonitrile.
| Compound Name | 4-[3-(1-methylbenzimidazol-2-yl)propylamino]quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 133346689 |
| Molecular Formula | C21H19N5 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-[3-(1-methylbenzimidazol-2-yl)propylamino]quinoline-2-carbonitrile |
| SMILES | Cn1c(CCCNc2cc(C#N)nc3ccccc23)nc2ccccc21 |
| InChI | InChI=1S/C21H19N5/c1-26-20-10-5-4-9-18(20)25-21(26)11-6-12-23-19-13-15(14-22)24-17-8-3-2-7-16(17)19/h2-5,7-10,13H,6,11-12H2,1H3,(H,23,24) |
| InChIKey | FSLOWBOSDXJYJP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|