C18H16N4O — CID 133316749
4-[(2-ethoxy-4-pyridinyl)methylamino]quinoline-2-carbonitrile (PubChem CID 133316749) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-[(2-ethoxy-4-pyridinyl)methylamino]quinoline-2-carbonitrile.
| Compound Name | 4-[(2-ethoxy-4-pyridinyl)methylamino]quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 133316749 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-[(2-ethoxy-4-pyridinyl)methylamino]quinoline-2-carbonitrile |
| SMILES | CCOc1cc(CNc2cc(C#N)nc3ccccc23)ccn1 |
| InChI | InChI=1S/C18H16N4O/c1-2-23-18-9-13(7-8-20-18)12-21-17-10-14(11-19)22-16-6-4-3-5-15(16)17/h3-10H,2,12H2,1H3,(H,21,22) |
| InChIKey | XBCOUXLHJQVHJG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |