C22H19N5 — CID 133351134
4-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methylamino]quinoline-2-carbonitrile (PubChem CID 133351134) has the molecular formula C22H19N5 and a molecular weight of 353.43 g/mol. Its IUPAC name is 4-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methylamino]quinoline-2-carbonitrile.
| Compound Name | 4-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methylamino]quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 133351134 |
| Molecular Formula | C22H19N5 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methylamino]quinoline-2-carbonitrile |
| SMILES | Cc1nccn1Cc1cccc(CNc2cc(C#N)nc3ccccc23)c1 |
| InChI | InChI=1S/C22H19N5/c1-16-24-9-10-27(16)15-18-6-4-5-17(11-18)14-25-22-12-19(13-23)26-21-8-3-2-7-20(21)22/h2-12H,14-15H2,1H3,(H,25,26) |
| InChIKey | QBSACJCEZZYIKA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |