C23H27N5 — CID 86984426
3-[N-methyl-4-[[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methylamino]methyl]anilino]propanenitrile (PubChem CID 86984426) has the molecular formula C23H27N5 and a molecular weight of 373.50 g/mol. Its IUPAC name is 3-[N-methyl-4-[[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methylamino]methyl]anilino]propanenitrile.
| Compound Name | 3-[N-methyl-4-[[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methylamino]methyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 86984426 |
| Molecular Formula | C23H27N5 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 3-[N-methyl-4-[[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methylamino]methyl]anilino]propanenitrile |
| SMILES | Cc1nccn1Cc1cccc(CNCc2ccc(N(C)CCC#N)cc2)c1 |
| InChI | InChI=1S/C23H27N5/c1-19-26-12-14-28(19)18-22-6-3-5-21(15-22)17-25-16-20-7-9-23(10-8-20)27(2)13-4-11-24/h3,5-10,12,14-15,25H,4,13,16-18H2,1-2H3 |
| InChIKey | OXHFLSSDSFJCDZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|