C22H22N4O — CID 133318713
4-[[3-(morpholin-4-ylmethyl)phenyl]methylamino]quinoline-2-carbonitrile (PubChem CID 133318713) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 4-[[3-(morpholin-4-ylmethyl)phenyl]methylamino]quinoline-2-carbonitrile.
| Compound Name | 4-[[3-(morpholin-4-ylmethyl)phenyl]methylamino]quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 133318713 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4-[[3-(morpholin-4-ylmethyl)phenyl]methylamino]quinoline-2-carbonitrile |
| SMILES | N#Cc1cc(NCc2cccc(CN3CCOCC3)c2)c2ccccc2n1 |
| InChI | InChI=1S/C22H22N4O/c23-14-19-13-22(20-6-1-2-7-21(20)25-19)24-15-17-4-3-5-18(12-17)16-26-8-10-27-11-9-26/h1-7,12-13H,8-11,15-16H2,(H,24,25) |
| InChIKey | OIJUFLIUUGYIOD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |