C21H20N4OS — CID 30091308
3-[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylmethyl]benzonitrile (PubChem CID 30091308) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is 3-[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylmethyl]benzonitrile.
| Compound Name | 3-[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 30091308 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylmethyl]benzonitrile |
| SMILES | N#Cc1cccc(CSc2nc(CN3CCOCC3)nc3ccccc23)c1 |
| InChI | InChI=1S/C21H20N4OS/c22-13-16-4-3-5-17(12-16)15-27-21-18-6-1-2-7-19(18)23-20(24-21)14-25-8-10-26-11-9-25/h1-7,12H,8-11,14-15H2 |
| InChIKey | FRXJHPKIAUZLCW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |