C20H16F5N3OS — CID 16581399
4-[[4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]quinazolin-2-yl]methyl]morpholine (PubChem CID 16581399) has the molecular formula C20H16F5N3OS and a molecular weight of 441.43 g/mol. Its IUPAC name is 4-[[4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]quinazolin-2-yl]methyl]morpholine.
| Compound Name | 4-[[4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]quinazolin-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 16581399 |
| Molecular Formula | C20H16F5N3OS |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 4-[[4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]quinazolin-2-yl]methyl]morpholine |
| SMILES | Fc1c(F)c(F)c(CSc2nc(CN3CCOCC3)nc3ccccc23)c(F)c1F |
| InChI | InChI=1S/C20H16F5N3OS/c21-15-12(16(22)18(24)19(25)17(15)23)10-30-20-11-3-1-2-4-13(11)26-14(27-20)9-28-5-7-29-8-6-28/h1-4H,5-10H2 |
| InChIKey | ZLHQYUOXFZGUDX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|