C18H18ClN3OS2 — CID 30091306
4-[[4-[(5-chlorothiophen-2-yl)methylsulfanyl]quinazolin-2-yl]methyl]morpholine (PubChem CID 30091306) has the molecular formula C18H18ClN3OS2 and a molecular weight of 391.95 g/mol. Its IUPAC name is 4-[[4-[(5-chlorothiophen-2-yl)methylsulfanyl]quinazolin-2-yl]methyl]morpholine.
| Compound Name | 4-[[4-[(5-chlorothiophen-2-yl)methylsulfanyl]quinazolin-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 30091306 |
| Molecular Formula | C18H18ClN3OS2 |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 4-[[4-[(5-chlorothiophen-2-yl)methylsulfanyl]quinazolin-2-yl]methyl]morpholine |
| SMILES | Clc1ccc(CSc2nc(CN3CCOCC3)nc3ccccc23)s1 |
| InChI | InChI=1S/C18H18ClN3OS2/c19-16-6-5-13(25-16)12-24-18-14-3-1-2-4-15(14)20-17(21-18)11-22-7-9-23-10-8-22/h1-6H,7-12H2 |
| InChIKey | WFNPQSUZJSCKNC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |