C22H22ClN3O2S — CID 16581408
1-(4-chlorophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylpropan-1-one (PubChem CID 16581408) has the molecular formula C22H22ClN3O2S and a molecular weight of 427.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylpropan-1-one.
| Compound Name | 1-(4-chlorophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylpropan-1-one |
|---|---|
| PubChem CID | 16581408 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylpropan-1-one |
| SMILES | CC(Sc1nc(CN2CCOCC2)nc2ccccc12)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClN3O2S/c1-15(21(27)16-6-8-17(23)9-7-16)29-22-18-4-2-3-5-19(18)24-20(25-22)14-26-10-12-28-13-11-26/h2-9,15H,10-14H2,1H3 |
| InChIKey | BCESZHYDCHPVNI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |