C22H22ClN5O4S — CID 55490611
N-(2-chloro-5-nitrophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylpropanamide (PubChem CID 55490611) has the molecular formula C22H22ClN5O4S and a molecular weight of 487.97 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylpropanamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 55490611 |
| Molecular Formula | C22H22ClN5O4S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nc(CN2CCOCC2)nc2ccccc12)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C22H22ClN5O4S/c1-14(21(29)25-19-12-15(28(30)31)6-7-17(19)23)33-22-16-4-2-3-5-18(16)24-20(26-22)13-27-8-10-32-11-9-27/h2-7,12,14H,8-11,13H2,1H3,(H,25,29) |
| InChIKey | BEVYIKXHQVKYFS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|