C28H28N4O2S — CID 46678835
N-(4-methylphenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanyl-2-phenylacetamide (PubChem CID 46678835) has the molecular formula C28H28N4O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanyl-2-phenylacetamide.
| Compound Name | N-(4-methylphenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 46678835 |
| Molecular Formula | C28H28N4O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-(4-methylphenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanyl-2-phenylacetamide |
| SMILES | Cc1ccc(NC(=O)C(Sc2nc(CN3CCOCC3)nc3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N4O2S/c1-20-11-13-22(14-12-20)29-27(33)26(21-7-3-2-4-8-21)35-28-23-9-5-6-10-24(23)30-25(31-28)19-32-15-17-34-18-16-32/h2-14,26H,15-19H2,1H3,(H,29,33) |
| InChIKey | KADYSHPLPYVKBI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |