C23H25FN4O2S — CID 24585309
N-(4-fluorophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylbutanamide (PubChem CID 24585309) has the molecular formula C23H25FN4O2S and a molecular weight of 440.54 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylbutanamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylbutanamide |
|---|---|
| PubChem CID | 24585309 |
| Molecular Formula | C23H25FN4O2S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylbutanamide |
| SMILES | CCC(Sc1nc(CN2CCOCC2)nc2ccccc12)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H25FN4O2S/c1-2-20(22(29)25-17-9-7-16(24)8-10-17)31-23-18-5-3-4-6-19(18)26-21(27-23)15-28-11-13-30-14-12-28/h3-10,20H,2,11-15H2,1H3,(H,25,29) |
| InChIKey | JTMZQBZOTMOSMB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |