C20H22N6O2S — CID 55497939
2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanyl-N-pyrimidin-2-ylpropanamide (PubChem CID 55497939) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanyl-N-pyrimidin-2-ylpropanamide.
| Compound Name | 2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanyl-N-pyrimidin-2-ylpropanamide |
|---|---|
| PubChem CID | 55497939 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanyl-N-pyrimidin-2-ylpropanamide |
| SMILES | CC(Sc1nc(CN2CCOCC2)nc2ccccc12)C(=O)Nc1ncccn1 |
| InChI | InChI=1S/C20H22N6O2S/c1-14(18(27)25-20-21-7-4-8-22-20)29-19-15-5-2-3-6-16(15)23-17(24-19)13-26-9-11-28-12-10-26/h2-8,14H,9-13H2,1H3,(H,21,22,25,27) |
| InChIKey | GJVHGIGAXJWYMX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |