C24H29N3O4 — CID 67051091
2-ethoxy-N-[4-[(2-hydroxy-2-methylpropyl)amino]-6-phenylmethoxyquinolin-3-yl]acetamide (PubChem CID 67051091) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-ethoxy-N-[4-[(2-hydroxy-2-methylpropyl)amino]-6-phenylmethoxyquinolin-3-yl]acetamide.
| Compound Name | 2-ethoxy-N-[4-[(2-hydroxy-2-methylpropyl)amino]-6-phenylmethoxyquinolin-3-yl]acetamide |
|---|---|
| PubChem CID | 67051091 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2-ethoxy-N-[4-[(2-hydroxy-2-methylpropyl)amino]-6-phenylmethoxyquinolin-3-yl]acetamide |
| SMILES | CCOCC(=O)Nc1cnc2ccc(OCc3ccccc3)cc2c1NCC(C)(C)O |
| InChI | InChI=1S/C24H29N3O4/c1-4-30-15-22(28)27-21-13-25-20-11-10-18(31-14-17-8-6-5-7-9-17)12-19(20)23(21)26-16-24(2,3)29/h5-13,29H,4,14-16H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | HYKQNRKKXSKSLI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |