C20H17NO5 — CID 10991740
dimethyl 6-phenylmethoxyquinoline-2,4-dicarboxylate (PubChem CID 10991740) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is dimethyl 6-phenylmethoxyquinoline-2,4-dicarboxylate.
| Compound Name | dimethyl 6-phenylmethoxyquinoline-2,4-dicarboxylate |
|---|---|
| PubChem CID | 10991740 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | dimethyl 6-phenylmethoxyquinoline-2,4-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)c2cc(OCc3ccccc3)ccc2n1 |
| InChI | InChI=1S/C20H17NO5/c1-24-19(22)16-11-18(20(23)25-2)21-17-9-8-14(10-15(16)17)26-12-13-6-4-3-5-7-13/h3-11H,12H2,1-2H3 |
| InChIKey | BHQGQFCHSCRWLU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |