C21H17NO4 — CID 11089322
dimethyl 6-[(E)-2-phenylethenyl]quinoline-2,4-dicarboxylate (PubChem CID 11089322) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is dimethyl 6-[(E)-2-phenylethenyl]quinoline-2,4-dicarboxylate.
| Compound Name | dimethyl 6-[(E)-2-phenylethenyl]quinoline-2,4-dicarboxylate |
|---|---|
| PubChem CID | 11089322 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | dimethyl 6-[(E)-2-phenylethenyl]quinoline-2,4-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)c2cc(/C=C/c3ccccc3)ccc2n1 |
| InChI | InChI=1S/C21H17NO4/c1-25-20(23)17-13-19(21(24)26-2)22-18-11-10-15(12-16(17)18)9-8-14-6-4-3-5-7-14/h3-13H,1-2H3/b9-8+ |
| InChIKey | KVLWXKRWHIMDDT-CMDGGOBGSA-N |
| XLogP | 3.98 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|