C29H24N2O6 — CID 91389777
2-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-6-(2-phenylethenyl)quinoline-4-carboxylic acid (PubChem CID 91389777) has the molecular formula C29H24N2O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is 2-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-6-(2-phenylethenyl)quinoline-4-carboxylic acid.
| Compound Name | 2-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-6-(2-phenylethenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 91389777 |
| Molecular Formula | C29H24N2O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 2-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-6-(2-phenylethenyl)quinoline-4-carboxylic acid |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c1cc(C(=O)O)c2cc(C=Cc3ccccc3)ccc2n1 |
| InChI | InChI=1S/C29H24N2O6/c1-37-29(36)26(16-20-9-12-21(32)13-10-20)31-27(33)25-17-23(28(34)35)22-15-19(11-14-24(22)30-25)8-7-18-5-3-2-4-6-18/h2-15,17,26,32H,16H2,1H3,(H,31,33)(H,34,35)/t26-/m0/s1 |
| InChIKey | PWANQLQYYXAWRB-SANMLTNESA-N |
| XLogP | 4.32 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|