C24H28N2O3S2 — CID 166511666
[(1R,2S)-1-(2,4,6-trimethylanilino)-2,3-dihydro-1H-inden-2-yl] 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate (PubChem CID 166511666) has the molecular formula C24H28N2O3S2 and a molecular weight of 456.63 g/mol. Its IUPAC name is [(1R,2S)-1-(2,4,6-trimethylanilino)-2,3-dihydro-1H-inden-2-yl] 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate.
| Compound Name | [(1R,2S)-1-(2,4,6-trimethylanilino)-2,3-dihydro-1H-inden-2-yl] 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate |
|---|---|
| PubChem CID | 166511666 |
| Molecular Formula | C24H28N2O3S2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [(1R,2S)-1-(2,4,6-trimethylanilino)-2,3-dihydro-1H-inden-2-yl] 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate |
| SMILES | Cc1cc(C)c(N[C@@H]2c3ccccc3C[C@@H]2OS(=O)c2cnc(C(C)(C)O)s2)c(C)c1 |
| InChI | InChI=1S/C24H28N2O3S2/c1-14-10-15(2)21(16(3)11-14)26-22-18-9-7-6-8-17(18)12-19(22)29-31(28)20-13-25-23(30-20)24(4,5)27/h6-11,13,19,22,26-27H,12H2,1-5H3/t19-,22+,31?/m0/s1 |
| InChIKey | HNXLKLNFCPDFTP-WFJWBZMCSA-N |
| XLogP | 5.11 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |