C40H24N3OPtS- — CID 166511739
2-[6-[4-deuterio-7-(3-thieno[3,2-d]pyrimidin-4-ylbenzene-2-id-1-yl)benzo[c]fluoren-7-yl]-2-pyridinyl]phenol;platinum (PubChem CID 166511739) has the molecular formula C40H24N3OPtS- and a molecular weight of 790.80 g/mol. Its IUPAC name is 2-[6-[4-deuterio-7-(3-thieno[3,2-d]pyrimidin-4-ylbenzene-2-id-1-yl)benzo[c]fluoren-7-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[4-deuterio-7-(3-thieno[3,2-d]pyrimidin-4-ylbenzene-2-id-1-yl)benzo[c]fluoren-7-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 166511739 |
| Molecular Formula | C40H24N3OPtS- |
| Molecular Weight | 790.80 g/mol |
| Exact Mass | 790.14 |
| IUPAC Name | 2-[6-[4-deuterio-7-(3-thieno[3,2-d]pyrimidin-4-ylbenzene-2-id-1-yl)benzo[c]fluoren-7-yl]-2-pyridinyl]phenol;platinum |
| SMILES | [2H]c1cccc2c3c(ccc12)C(c1[c-]c(-c2ncnc4ccsc24)ccc1)(c1cccc(-c2ccccc2O)n1)c1ccccc1-3.[Pt] |
| InChI | InChI=1S/C40H24N3OS.Pt/c44-35-17-6-4-14-30(35)33-16-8-18-36(43-33)40(27-11-7-10-26(23-27)38-39-34(21-22-45-39)41-24-42-38)31-15-5-3-13-29(31)37-28-12-2-1-9-25(28)19-20-32(37)40;/h1-22,24,44H;/q-1;/i9D; |
| InChIKey | LQHNSBLUEZPKSA-GTIFXZTCSA-N |
| XLogP | 9.44 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.80 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|