C39H25N4OPt- — CID 166511806
2-[6-[9-[3-(4-phenyl-1,3,5-triazin-2-yl)benzene-2-id-1-yl]fluoren-9-yl]-2-pyridinyl]phenol;platinum (PubChem CID 166511806) has the molecular formula C39H25N4OPt- and a molecular weight of 760.73 g/mol. Its IUPAC name is 2-[6-[9-[3-(4-phenyl-1,3,5-triazin-2-yl)benzene-2-id-1-yl]fluoren-9-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[9-[3-(4-phenyl-1,3,5-triazin-2-yl)benzene-2-id-1-yl]fluoren-9-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 166511806 |
| Molecular Formula | C39H25N4OPt- |
| Molecular Weight | 760.73 g/mol |
| Exact Mass | 760.17 |
| IUPAC Name | 2-[6-[9-[3-(4-phenyl-1,3,5-triazin-2-yl)benzene-2-id-1-yl]fluoren-9-yl]-2-pyridinyl]phenol;platinum |
| SMILES | Oc1ccccc1-c1cccc(C2(c3[c-]c(-c4ncnc(-c5ccccc5)n4)ccc3)c3ccccc3-c3ccccc32)n1.[Pt] |
| InChI | InChI=1S/C39H25N4O.Pt/c44-35-22-9-6-18-31(35)34-21-11-23-36(42-34)39(32-19-7-4-16-29(32)30-17-5-8-20-33(30)39)28-15-10-14-27(24-28)38-41-25-40-37(43-38)26-12-2-1-3-13-26;/h1-23,25,44H;/q-1; |
| InChIKey | WCJYUDKUEAMGST-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.73 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|