C19H19ClN4O3 — CID 16651720
N-(2-chloro-5-methoxyphenyl)-5-(methoxymethyl)-1-(3-methylphenyl)triazole-4-carboxamide (PubChem CID 16651720) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-5-(methoxymethyl)-1-(3-methylphenyl)triazole-4-carboxamide.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-5-(methoxymethyl)-1-(3-methylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 16651720 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-5-(methoxymethyl)-1-(3-methylphenyl)triazole-4-carboxamide |
| SMILES | COCc1c(C(=O)Nc2cc(OC)ccc2Cl)nnn1-c1cccc(C)c1 |
| InChI | InChI=1S/C19H19ClN4O3/c1-12-5-4-6-13(9-12)24-17(11-26-2)18(22-23-24)19(25)21-16-10-14(27-3)7-8-15(16)20/h4-10H,11H2,1-3H3,(H,21,25) |
| InChIKey | JLQYUFICFATZCK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |