C24H22ClNO2 — CID 166517433
ethyl 3-(benzhydrylideneamino)-3-(3-chlorophenyl)propanoate (PubChem CID 166517433) has the molecular formula C24H22ClNO2 and a molecular weight of 391.90 g/mol. Its IUPAC name is ethyl 3-(benzhydrylideneamino)-3-(3-chlorophenyl)propanoate.
| Compound Name | ethyl 3-(benzhydrylideneamino)-3-(3-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 166517433 |
| Molecular Formula | C24H22ClNO2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | ethyl 3-(benzhydrylideneamino)-3-(3-chlorophenyl)propanoate |
| SMILES | CCOC(=O)CC(N=C(c1ccccc1)c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H22ClNO2/c1-2-28-23(27)17-22(20-14-9-15-21(25)16-20)26-24(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-16,22H,2,17H2,1H3 |
| InChIKey | UHBLCSDAYUKZBR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|