C17H18BNO5 — CID 166518703
[4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-3-methylphenyl]boronic acid (PubChem CID 166518703) has the molecular formula C17H18BNO5 and a molecular weight of 327.15 g/mol. Its IUPAC name is [4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-3-methylphenyl]boronic acid.
| Compound Name | [4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-3-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 166518703 |
| Molecular Formula | C17H18BNO5 |
| Molecular Weight | 327.15 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-3-methylphenyl]boronic acid |
| SMILES | Cc1cc(B(O)O)ccc1CC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H18BNO5/c1-11-8-13(18(21)22)3-2-12(11)9-17(20)19-14-4-5-15-16(10-14)24-7-6-23-15/h2-5,8,10,21-22H,6-7,9H2,1H3,(H,19,20) |
| InChIKey | RGGMCSVZYLIERH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|