C33H30BrF3N3O2Si — CID 166519077
CID 166519077 (PubChem CID 166519077) has the molecular formula C33H30BrF3N3O2Si and a molecular weight of 665.61 g/mol.
| Compound Name | CID 166519077 |
|---|---|
| PubChem CID | 166519077 |
| Molecular Formula | C33H30BrF3N3O2Si |
| Molecular Weight | 665.61 g/mol |
| Exact Mass | 664.12 |
| IUPAC Name | — |
| SMILES | CC(CO[Si](c1ccccc1-c1ccccc1)C(C)(C)C)n1cnc2c(Br)nc(-c3ccc(C(F)(F)F)cc3)cc2c1=O |
| InChI | InChI=1S/C33H30BrF3N3O2Si/c1-21(19-42-43(32(2,3)4)28-13-9-8-12-25(28)22-10-6-5-7-11-22)40-20-38-29-26(31(40)41)18-27(39-30(29)34)23-14-16-24(17-15-23)33(35,36)37/h5-18,20-21H,19H2,1-4H3 |
| InChIKey | OYRNKLKGRIRMIX-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.61 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|