About tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate
tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate (PubChem CID 166523999) has the molecular formula C21H25N3O2
and a molecular weight of 351.45 g/mol. Its IUPAC name is tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate |
| PubChem CID | 166523999 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate |
| SMILES | Cc1ccc(C)n1-c1ccc(C2C=CN(C(=O)OC(C)(C)C)C=C2)cn1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-6-7-16(2)24(15)19-9-8-18(14-22-19)17-10-12-23(13-11-17)20(25)26-21(3,4)5/h6-14,17H,1-5H3 |
| InChIKey | GCCKACOMQXJRLJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate?
The IUPAC name of tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate (CID 166523999) is tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate is Cc1ccc(C)n1-c1ccc(C2C=CN(C(=O)OC(C)(C)C)C=C2)cn1.
What is the InChIKey of tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate?
The InChIKey is GCCKACOMQXJRLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O2/c1-15-6-7-16(2)24(15)19-9-8-18(14-22-19)17-10-12-23(13-11-17)20(25)26-21(3,4)5/h6-14,17H,1-5H3.
What are the key properties of tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate?
tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate has a molecular weight of 351.45 g/mol, XLogP of 4.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-4H-pyridine-1-carboxylate is sourced from PubChem (CID 166523999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).