C19H17N5O — CID 16652491
(E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-(tetrazol-1-yl)phenyl]prop-2-en-1-one (PubChem CID 16652491) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is (E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-(tetrazol-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-(tetrazol-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 16652491 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-(tetrazol-1-yl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(-n2cnnn2)c1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H17N5O/c25-19(23-11-10-16-5-1-2-6-17(16)13-23)9-8-15-4-3-7-18(12-15)24-14-20-21-22-24/h1-9,12,14H,10-11,13H2/b9-8+ |
| InChIKey | GXPIVHDPDONDIP-CMDGGOBGSA-N |
| XLogP | 2.26 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|