C20H17F2NO — CID 156899892
(2E,4E)-5-(3,4-difluorophenyl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)penta-2,4-dien-1-one (PubChem CID 156899892) has the molecular formula C20H17F2NO and a molecular weight of 325.36 g/mol. Its IUPAC name is (2E,4E)-5-(3,4-difluorophenyl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(3,4-difluorophenyl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 156899892 |
| Molecular Formula | C20H17F2NO |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2E,4E)-5-(3,4-difluorophenyl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)penta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccc(F)c(F)c1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H17F2NO/c21-18-10-9-15(13-19(18)22)5-1-4-8-20(24)23-12-11-16-6-2-3-7-17(16)14-23/h1-10,13H,11-12,14H2/b5-1+,8-4+ |
| InChIKey | QTRFZUMRENETHP-LZSLGQGWSA-N |
| XLogP | 4.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|