C20H20N2O3 — CID 156899964
(2E,4E)-5-(2-amino-4,5-dihydroxyphenyl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)penta-2,4-dien-1-one (PubChem CID 156899964) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (2E,4E)-5-(2-amino-4,5-dihydroxyphenyl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(2-amino-4,5-dihydroxyphenyl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 156899964 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (2E,4E)-5-(2-amino-4,5-dihydroxyphenyl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)penta-2,4-dien-1-one |
| SMILES | Nc1cc(O)c(O)cc1/C=C/C=C/C(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H20N2O3/c21-17-12-19(24)18(23)11-15(17)6-3-4-8-20(25)22-10-9-14-5-1-2-7-16(14)13-22/h1-8,11-12,23-24H,9-10,13,21H2/b6-3+,8-4+ |
| InChIKey | RXHDGXJBIAQBFV-PHQNLGIASA-N |
| XLogP | 2.83 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|