C26H27F7N4O2 — CID 166525233
2-[3-[5-[(R)-(1,3-dimethylazetidin-3-yl)-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-hydroxymethyl]-3-pyridinyl]-1H-pyrazol-5-yl]propan-2-ol (PubChem CID 166525233) has the molecular formula C26H27F7N4O2 and a molecular weight of 560.51 g/mol. Its IUPAC name is 2-[3-[5-[(R)-(1,3-dimethylazetidin-3-yl)-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-hydroxymethyl]-3-pyridinyl]-1H-pyrazol-5-yl]propan-2-ol.
| Compound Name | 2-[3-[5-[(R)-(1,3-dimethylazetidin-3-yl)-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-hydroxymethyl]-3-pyridinyl]-1H-pyrazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 166525233 |
| Molecular Formula | C26H27F7N4O2 |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | 2-[3-[5-[(R)-(1,3-dimethylazetidin-3-yl)-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-hydroxymethyl]-3-pyridinyl]-1H-pyrazol-5-yl]propan-2-ol |
| SMILES | CN1CC(C)([C@](O)(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)c2cncc(-c3cc(C(C)(C)O)[nH]n3)c2)C1 |
| InChI | InChI=1S/C26H27F7N4O2/c1-21(2,38)20-10-19(35-36-20)15-9-18(12-34-11-15)23(39,22(3)13-37(4)14-22)16-5-7-17(8-6-16)24(27,25(28,29)30)26(31,32)33/h5-12,38-39H,13-14H2,1-4H3,(H,35,36)/t23-/m0/s1 |
| InChIKey | NAXOKYRTSFJCAZ-QHCPKHFHSA-N |
| XLogP | 5.18 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |