C15H13N3O — CID 50956474
[4-[4-(1H-pyrazol-5-yl)phenyl]-2-pyridinyl]methanol (PubChem CID 50956474) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is [4-[4-(1H-pyrazol-5-yl)phenyl]-2-pyridinyl]methanol.
| Compound Name | [4-[4-(1H-pyrazol-5-yl)phenyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 50956474 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | [4-[4-(1H-pyrazol-5-yl)phenyl]-2-pyridinyl]methanol |
| SMILES | OCc1cc(-c2ccc(-c3ccn[nH]3)cc2)ccn1 |
| InChI | InChI=1S/C15H13N3O/c19-10-14-9-13(5-7-16-14)11-1-3-12(4-2-11)15-6-8-17-18-15/h1-9,19H,10H2,(H,17,18) |
| InChIKey | XKUHITFOVMLJRS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |