C15H13N5O2 — CID 16652530
(E)-N-(furan-2-ylmethyl)-3-[4-(tetrazol-1-yl)phenyl]prop-2-enamide (PubChem CID 16652530) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is (E)-N-(furan-2-ylmethyl)-3-[4-(tetrazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(furan-2-ylmethyl)-3-[4-(tetrazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16652530 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (E)-N-(furan-2-ylmethyl)-3-[4-(tetrazol-1-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-n2cnnn2)cc1)NCc1ccco1 |
| InChI | InChI=1S/C15H13N5O2/c21-15(16-10-14-2-1-9-22-14)8-5-12-3-6-13(7-4-12)20-11-17-18-19-20/h1-9,11H,10H2,(H,16,21)/b8-5+ |
| InChIKey | RSPUMYZEUGGNCB-VMPITWQZSA-N |
| XLogP | 1.58 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|