C21H21F2N5O3 — CID 166525615
methyl N-[[5-[2-[2,6-difluoro-4-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]triazol-4-yl]-2-methylphenyl]methyl]carbamate (PubChem CID 166525615) has the molecular formula C21H21F2N5O3 and a molecular weight of 429.43 g/mol. Its IUPAC name is methyl N-[[5-[2-[2,6-difluoro-4-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]triazol-4-yl]-2-methylphenyl]methyl]carbamate.
| Compound Name | methyl N-[[5-[2-[2,6-difluoro-4-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]triazol-4-yl]-2-methylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 166525615 |
| Molecular Formula | C21H21F2N5O3 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | methyl N-[[5-[2-[2,6-difluoro-4-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]triazol-4-yl]-2-methylphenyl]methyl]carbamate |
| SMILES | CO/N=C(\C)c1cc(F)c(-n2ncc(-c3ccc(C)c(CNC(=O)OC)c3)n2)c(F)c1 |
| InChI | InChI=1S/C21H21F2N5O3/c1-12-5-6-14(7-16(12)10-24-21(29)30-3)19-11-25-28(26-19)20-17(22)8-15(9-18(20)23)13(2)27-31-4/h5-9,11H,10H2,1-4H3,(H,24,29)/b27-13+ |
| InChIKey | FLXNZCFYERSIDT-UVHMKAGCSA-N |
| XLogP | 3.75 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|