C23H17F5N4O2 — CID 166525960
4-(difluoromethyl)-N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-6-fluoro-N-methyl-1H-indole-2-carboxamide (PubChem CID 166525960) has the molecular formula C23H17F5N4O2 and a molecular weight of 476.41 g/mol. Its IUPAC name is 4-(difluoromethyl)-N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-6-fluoro-N-methyl-1H-indole-2-carboxamide.
| Compound Name | 4-(difluoromethyl)-N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-6-fluoro-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166525960 |
| Molecular Formula | C23H17F5N4O2 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 4-(difluoromethyl)-N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-6-fluoro-N-methyl-1H-indole-2-carboxamide |
| SMILES | CN(C(=O)c1cc2c(C(F)F)cc(F)cc2[nH]1)[C@H]1CNCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C23H17F5N4O2/c1-32(23(34)17-6-10-12(21(27)28)2-9(24)3-16(10)30-17)19-8-29-7-18-20(19)11-4-14(25)15(26)5-13(11)22(33)31-18/h2-6,19,21,29-30H,7-8H2,1H3,(H,31,33)/t19-/m0/s1 |
| InChIKey | DHZVYQSVDGCRDY-IBGZPJMESA-N |
| XLogP | 4.28 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |