C23H20F2N4O4S — CID 166526087
N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-N-methyl-5-methylsulfonyl-1H-indole-2-carboxamide (PubChem CID 166526087) has the molecular formula C23H20F2N4O4S and a molecular weight of 486.50 g/mol. Its IUPAC name is N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-N-methyl-5-methylsulfonyl-1H-indole-2-carboxamide.
| Compound Name | N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-N-methyl-5-methylsulfonyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166526087 |
| Molecular Formula | C23H20F2N4O4S |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-N-methyl-5-methylsulfonyl-1H-indole-2-carboxamide |
| SMILES | CN(C(=O)c1cc2cc(S(C)(=O)=O)ccc2[nH]1)[C@H]1CNCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C23H20F2N4O4S/c1-29(23(31)18-6-11-5-12(34(2,32)33)3-4-17(11)27-18)20-10-26-9-19-21(20)13-7-15(24)16(25)8-14(13)22(30)28-19/h3-8,20,26-27H,9-10H2,1-2H3,(H,28,30)/t20-/m0/s1 |
| InChIKey | QSFBMAXQGAAGOV-FQEVSTJZSA-N |
| XLogP | 2.61 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |